C29H27N5O7 — CID 2977914
2-tert-butyl-N-[3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-2-cyano-3-oxopropanoyl]imino-1,3-dihydroxyisoindole-5-carboxamide (PubChem CID 2977914) has the molecular formula C29H27N5O7 and a molecular weight of 557.56 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-2-cyano-3-oxopropanoyl]imino-1,3-dihydroxyisoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-2-cyano-3-oxopropanoyl]imino-1,3-dihydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2977914 |
| Molecular Formula | C29H27N5O7 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2-tert-butyl-N-[3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-2-cyano-3-oxopropanoyl]imino-1,3-dihydroxyisoindole-5-carboxamide |
| SMILES | CC(C)(C)N1C(=O)c2ccc(C(=O)C(C#N)C(=O)/N=N/C(=O)c3ccc4c(O)n(C(C)(C)C)c(O)c4c3)cc2C1=O |
| InChI | InChI=1S/C29H27N5O7/c1-28(2,3)33-24(38)16-9-7-14(11-18(16)26(33)40)21(35)20(13-30)23(37)32-31-22(36)15-8-10-17-19(12-15)27(41)34(25(17)39)29(4,5)6/h7-12,20,39,41H,1-6H3/b32-31+ |
| InChIKey | RNNOEWJVEIFMSM-QNEJGDQOSA-N |
| XLogP | 4.34 |
| TPSA | 182.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|