C18H14ClN5O5 — CID 2978023
methyl 7-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 2978023) has the molecular formula C18H14ClN5O5 and a molecular weight of 415.79 g/mol. Its IUPAC name is methyl 7-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2978023 |
| Molecular Formula | C18H14ClN5O5 |
| Molecular Weight | 415.79 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | methyl 7-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2ncnn2C1c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C18H14ClN5O5/c1-9-15(17(25)28-2)16(23-18(22-9)20-8-21-23)14-6-5-13(29-14)11-4-3-10(24(26)27)7-12(11)19/h3-8,16H,1-2H3,(H,20,21,22) |
| InChIKey | CYYIEQNLBNLHEV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|