C22H22N4OS2 — CID 2978297
2-(1-sulfanylidene-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-2-yl)-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone (PubChem CID 2978297) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-(1-sulfanylidene-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-2-yl)-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone.
| Compound Name | 2-(1-sulfanylidene-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-2-yl)-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 2978297 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-(1-sulfanylidene-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-2-yl)-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone |
| SMILES | CC1CC(C)(C)N(C(=O)Cn2nc3sc4ccccc4n3c2=S)c2ccccc21 |
| InChI | InChI=1S/C22H22N4OS2/c1-14-12-22(2,3)26(16-9-5-4-8-15(14)16)19(27)13-24-21(28)25-17-10-6-7-11-18(17)29-20(25)23-24/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | IHVKZBIGDBHPJA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|