About 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one
2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 2978447) has the molecular formula C15H15N3O
and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one.
Molecular Properties
| Compound Name | 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one |
| PubChem CID | 2978447 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | CC1CC(=O)c2cnc(Nc3ccccc3)nc2C1 |
| InChI | InChI=1S/C15H15N3O/c1-10-7-13-12(14(19)8-10)9-16-15(18-13)17-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,16,17,18) |
| InChIKey | JPPUUZHXXFEOQF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one?
The IUPAC name of 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one (CID 2978447) is 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one.
What is the SMILES notation for 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one?
The canonical SMILES for 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one is CC1CC(=O)c2cnc(Nc3ccccc3)nc2C1.
What is the InChIKey of 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one?
The InChIKey is JPPUUZHXXFEOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O/c1-10-7-13-12(14(19)8-10)9-16-15(18-13)17-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,16,17,18).
What are the key properties of 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one?
2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one has a molecular weight of 253.31 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-7-methyl-7,8-dihydro-6H-quinazolin-5-one is sourced from PubChem (CID 2978447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).