C21H18Cl3N3O2S — CID 2978537
N-(2-chlorophenyl)-4-(3,5-dichloro-4-prop-2-enoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 2978537) has the molecular formula C21H18Cl3N3O2S and a molecular weight of 482.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(3,5-dichloro-4-prop-2-enoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-(3,5-dichloro-4-prop-2-enoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 2978537 |
| Molecular Formula | C21H18Cl3N3O2S |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | N-(2-chlorophenyl)-4-(3,5-dichloro-4-prop-2-enoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | C=CCOc1c(Cl)cc(C2NC(=S)NC(C)=C2C(=O)Nc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl3N3O2S/c1-3-8-29-19-14(23)9-12(10-15(19)24)18-17(11(2)25-21(30)27-18)20(28)26-16-7-5-4-6-13(16)22/h3-7,9-10,18H,1,8H2,2H3,(H,26,28)(H2,25,27,30) |
| InChIKey | ONXOHVHCBNBACY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|