C18H22O4 — CID 2978619
(3,5-dimethylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 2978619) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (3,5-dimethylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 2978619 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3,5-dimethylphenyl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | Cc1cc(C)cc(OC(=O)C23CCC(C)(C(=O)O2)C3(C)C)c1 |
| InChI | InChI=1S/C18H22O4/c1-11-8-12(2)10-13(9-11)21-15(20)18-7-6-17(5,14(19)22-18)16(18,3)4/h8-10H,6-7H2,1-5H3 |
| InChIKey | RVBTZBDMGBJGEF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|