About N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide
N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide (PubChem CID 2978829) has the molecular formula C12H12Cl2N2O2S
and a molecular weight of 319.21 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide |
| PubChem CID | 2978829 |
| Molecular Formula | C12H12Cl2N2O2S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide |
| SMILES | O=C(CC1SCCNC1=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O2S/c13-7-3-8(14)5-9(4-7)16-11(17)6-10-12(18)15-1-2-19-10/h3-5,10H,1-2,6H2,(H,15,18)(H,16,17) |
| InChIKey | STOJKQCUBMGMLA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide?
The IUPAC name of N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide (CID 2978829) is N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide.
What is the SMILES notation for N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide?
The canonical SMILES for N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide is O=C(CC1SCCNC1=O)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide?
The InChIKey is STOJKQCUBMGMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O2S/c13-7-3-8(14)5-9(4-7)16-11(17)6-10-12(18)15-1-2-19-10/h3-5,10H,1-2,6H2,(H,15,18)(H,16,17).
What are the key properties of N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide?
N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide has a molecular weight of 319.21 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichlorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide is sourced from PubChem (CID 2978829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).