C21H21N3O3S — CID 2979135
3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione (PubChem CID 2979135) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2979135 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCC(c3nc4ccccc4o3)CC2)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C21H21N3O3S/c25-19-12-17(21(26)24(19)13-15-4-3-11-28-15)23-9-7-14(8-10-23)20-22-16-5-1-2-6-18(16)27-20/h1-6,11,14,17H,7-10,12-13H2 |
| InChIKey | HNDWFGSXQQWWHK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|