About 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride
2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride (PubChem CID 2979184) has the molecular formula C17H22ClNO3
and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride |
| PubChem CID | 2979184 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride |
| SMILES | Cl.OCC(CO)(CO)NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO3.ClH/c19-11-17(12-20,13-21)18-10-14-6-8-16(9-7-14)15-4-2-1-3-5-15;/h1-9,18-21H,10-13H2;1H |
| InChIKey | WSNRBNNBLOVFDM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride?
The IUPAC name of 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride (CID 2979184) is 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride?
The canonical SMILES for 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride is Cl.OCC(CO)(CO)NCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride?
The InChIKey is WSNRBNNBLOVFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3.ClH/c19-11-17(12-20,13-21)18-10-14-6-8-16(9-7-14)15-4-2-1-3-5-15;/h1-9,18-21H,10-13H2;1H.
What are the key properties of 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride?
2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride has a molecular weight of 323.82 g/mol, XLogP of 1.58, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-[(4-phenylphenyl)methylamino]propane-1,3-diol;hydrochloride is sourced from PubChem (CID 2979184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).