C16H25NO2S — CID 2979217
N-cyclohexyl-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 2979217) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-cyclohexyl-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2979217 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-cyclohexyl-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC2CCCCC2)c1C |
| InChI | InChI=1S/C16H25NO2S/c1-11-10-12(2)14(4)16(13(11)3)20(18,19)17-15-8-6-5-7-9-15/h10,15,17H,5-9H2,1-4H3 |
| InChIKey | QGELOHPUTIAKLJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |