About 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole
5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole (PubChem CID 2979457) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole |
| PubChem CID | 2979457 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole |
| SMILES | CCCCc1nc(SCc2ccc([N+](=O)[O-])cc2)n[nH]1 |
| InChI | InChI=1S/C13H16N4O2S/c1-2-3-4-12-14-13(16-15-12)20-9-10-5-7-11(8-6-10)17(18)19/h5-8H,2-4,9H2,1H3,(H,14,15,16) |
| InChIKey | CZGDJDCQJLWJBZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole?
The IUPAC name of 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole (CID 2979457) is 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole.
What is the SMILES notation for 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole?
The canonical SMILES for 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole is CCCCc1nc(SCc2ccc([N+](=O)[O-])cc2)n[nH]1.
What is the InChIKey of 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole?
The InChIKey is CZGDJDCQJLWJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-2-3-4-12-14-13(16-15-12)20-9-10-5-7-11(8-6-10)17(18)19/h5-8H,2-4,9H2,1H3,(H,14,15,16).
What are the key properties of 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole?
5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole has a molecular weight of 292.36 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazole is sourced from PubChem (CID 2979457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).