C19H14N2O2S — CID 2979650
N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]furan-2-carboxamide (PubChem CID 2979650) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]furan-2-carboxamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2979650 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(-c2nc3ccccc3s2)cc1)c1ccco1 |
| InChI | InChI=1S/C19H14N2O2S/c22-18(16-5-3-11-23-16)20-12-13-7-9-14(10-8-13)19-21-15-4-1-2-6-17(15)24-19/h1-11H,12H2,(H,20,22) |
| InChIKey | STNUUELXYLFSBC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |