C20H27ClN6O3 — CID 2979849
7-[(2-chloro-5-methoxyphenyl)methyl]-8-[3-(dimethylamino)propylamino]-1,3-dimethylpurine-2,6-dione (PubChem CID 2979849) has the molecular formula C20H27ClN6O3 and a molecular weight of 434.93 g/mol. Its IUPAC name is 7-[(2-chloro-5-methoxyphenyl)methyl]-8-[3-(dimethylamino)propylamino]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2-chloro-5-methoxyphenyl)methyl]-8-[3-(dimethylamino)propylamino]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 2979849 |
| Molecular Formula | C20H27ClN6O3 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 7-[(2-chloro-5-methoxyphenyl)methyl]-8-[3-(dimethylamino)propylamino]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(Cl)c(Cn2c(NCCCN(C)C)nc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C20H27ClN6O3/c1-24(2)10-6-9-22-19-23-17-16(18(28)26(4)20(29)25(17)3)27(19)12-13-11-14(30-5)7-8-15(13)21/h7-8,11H,6,9-10,12H2,1-5H3,(H,22,23) |
| InChIKey | IDDWWADKKFJVFN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|