C17H25N3O2 — CID 2980403
3-N,3-N-diethyl-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 2980403) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-diethyl-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2980403 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 3-N,3-N-diethyl-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-19(4-2)16(21)14-9-8-12-20(13-14)17(22)18-15-10-6-5-7-11-15/h5-7,10-11,14H,3-4,8-9,12-13H2,1-2H3,(H,18,22) |
| InChIKey | QVQQDKIQFHHVNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |