About 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide
5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 2980511) has the molecular formula C10H12ClN3O3S2
and a molecular weight of 321.81 g/mol. Its IUPAC name is 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide |
| PubChem CID | 2980511 |
| Molecular Formula | C10H12ClN3O3S2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Cl)c(C(=O)NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H12ClN3O3S2/c1-18-10-12-4-7(11)8(14-10)9(15)13-6-2-3-19(16,17)5-6/h4,6H,2-3,5H2,1H3,(H,13,15) |
| InChIKey | GIWUPDIEDFBUAB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide?
The IUPAC name of 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide (CID 2980511) is 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide.
What is the SMILES notation for 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide?
The canonical SMILES for 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide is CSc1ncc(Cl)c(C(=O)NC2CCS(=O)(=O)C2)n1.
What is the InChIKey of 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide?
The InChIKey is GIWUPDIEDFBUAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O3S2/c1-18-10-12-4-7(11)8(14-10)9(15)13-6-2-3-19(16,17)5-6/h4,6H,2-3,5H2,1H3,(H,13,15).
What are the key properties of 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide?
5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide has a molecular weight of 321.81 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(1,1-dioxothiolan-3-yl)-2-methylsulfanylpyrimidine-4-carboxamide is sourced from PubChem (CID 2980511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).