About 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone
1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone (PubChem CID 2980597) has the molecular formula C14H13N5OS
and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone |
| PubChem CID | 2980597 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone |
| SMILES | CC(=O)n1nc(-c2cccnc2)nc1NCc1cccs1 |
| InChI | InChI=1S/C14H13N5OS/c1-10(20)19-14(16-9-12-5-3-7-21-12)17-13(18-19)11-4-2-6-15-8-11/h2-8H,9H2,1H3,(H,16,17,18) |
| InChIKey | MSSONLYTKLKLNM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone?
The IUPAC name of 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone (CID 2980597) is 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone.
What is the SMILES notation for 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone?
The canonical SMILES for 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone is CC(=O)n1nc(-c2cccnc2)nc1NCc1cccs1.
What is the InChIKey of 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone?
The InChIKey is MSSONLYTKLKLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5OS/c1-10(20)19-14(16-9-12-5-3-7-21-12)17-13(18-19)11-4-2-6-15-8-11/h2-8H,9H2,1H3,(H,16,17,18).
What are the key properties of 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone?
1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone has a molecular weight of 299.36 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-pyridin-3-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]ethanone is sourced from PubChem (CID 2980597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).