About 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide
1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide (PubChem CID 2980621) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide |
| PubChem CID | 2980621 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CC(=O)N(Cc3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C15H19N3O3S/c16-14(20)10-3-5-17(6-4-10)12-8-13(19)18(15(12)21)9-11-2-1-7-22-11/h1-2,7,10,12H,3-6,8-9H2,(H2,16,20) |
| InChIKey | HASOUSDLYGRKBC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide?
The IUPAC name of 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide (CID 2980621) is 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide?
The canonical SMILES for 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide is NC(=O)C1CCN(C2CC(=O)N(Cc3cccs3)C2=O)CC1.
What is the InChIKey of 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide?
The InChIKey is HASOUSDLYGRKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c16-14(20)10-3-5-17(6-4-10)12-8-13(19)18(15(12)21)9-11-2-1-7-22-11/h1-2,7,10,12H,3-6,8-9H2,(H2,16,20).
What are the key properties of 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide?
1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide has a molecular weight of 321.40 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]piperidine-4-carboxamide is sourced from PubChem (CID 2980621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).