C18H15ClIN3O3 — CID 2980706
N-(2-chlorophenyl)-4-(4-hydroxy-3-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 2980706) has the molecular formula C18H15ClIN3O3 and a molecular weight of 483.69 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(4-hydroxy-3-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-(4-hydroxy-3-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 2980706 |
| Molecular Formula | C18H15ClIN3O3 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | N-(2-chlorophenyl)-4-(4-hydroxy-3-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2Cl)C(c2ccc(O)c(I)c2)NC(=O)N1 |
| InChI | InChI=1S/C18H15ClIN3O3/c1-9-15(17(25)22-13-5-3-2-4-11(13)19)16(23-18(26)21-9)10-6-7-14(24)12(20)8-10/h2-8,16,24H,1H3,(H,22,25)(H2,21,23,26) |
| InChIKey | QHLYXCCXMPGGAU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|