C20H11F4N3O3 — CID 2980791
2,3,5,6-tetrafluoro-4-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 2980791) has the molecular formula C20H11F4N3O3 and a molecular weight of 417.32 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 2980791 |
| Molecular Formula | C20H11F4N3O3 |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | COc1c(F)c(F)c(C(=O)Nc2ccc3oc(-c4ccncc4)nc3c2)c(F)c1F |
| InChI | InChI=1S/C20H11F4N3O3/c1-29-18-16(23)14(21)13(15(22)17(18)24)19(28)26-10-2-3-12-11(8-10)27-20(30-12)9-4-6-25-7-5-9/h2-8H,1H3,(H,26,28) |
| InChIKey | CAAYKWSQNAIJKW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|