About N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine
N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine (PubChem CID 2981024) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine |
| PubChem CID | 2981024 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccco1)C1CCCC1 |
| InChI | InChI=1S/C13H22N2O/c14-8-4-9-15(12-5-1-2-6-12)11-13-7-3-10-16-13/h3,7,10,12H,1-2,4-6,8-9,11,14H2 |
| InChIKey | QJLUAFKAADLDRO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine (CID 2981024) is N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine is NCCCN(Cc1ccco1)C1CCCC1.
What is the InChIKey of N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine?
The InChIKey is QJLUAFKAADLDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c14-8-4-9-15(12-5-1-2-6-12)11-13-7-3-10-16-13/h3,7,10,12H,1-2,4-6,8-9,11,14H2.
What are the key properties of N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine?
N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine has a molecular weight of 222.33 g/mol, XLogP of 2.37, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N'-(furan-2-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 2981024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).