C23H26ClN5O2S — CID 2981260
2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide (PubChem CID 2981260) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is 2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2981260 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCn1c(Cc2ccccc2)nnc1SCC(=O)Nc1ccc(N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClN5O2S/c1-2-29-21(14-17-6-4-3-5-7-17)26-27-23(29)32-16-22(30)25-18-8-9-20(19(24)15-18)28-10-12-31-13-11-28/h3-9,15H,2,10-14,16H2,1H3,(H,25,30) |
| InChIKey | NSDWJQFPGRATOX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|