About 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide
2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide (PubChem CID 2981480) has the molecular formula C16H17BrN2O2
and a molecular weight of 349.23 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide.
Molecular Properties
| Compound Name | 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide |
| PubChem CID | 2981480 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\c2ccccc2CN1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H16N2O2.BrH/c1-19-12-7-8-15(20-2)14(9-12)18-10-11-5-3-4-6-13(11)16(18)17;/h3-9,17H,10H2,1-2H3;1H/b17-16+; |
| InChIKey | PZWQSXUITXIEAU-CMBBICFISA-N |
| XLogP | 3.63 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide?
The IUPAC name of 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide (CID 2981480) is 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide.
What is the SMILES notation for 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide?
The canonical SMILES for 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide is Br.[H]/N=C1\c2ccccc2CN1c1cc(OC)ccc1OC.
What is the InChIKey of 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide?
The InChIKey is PZWQSXUITXIEAU-CMBBICFISA-N. The full InChI is InChI=1S/C16H16N2O2.BrH/c1-19-12-7-8-15(20-2)14(9-12)18-10-11-5-3-4-6-13(11)16(18)17;/h3-9,17H,10H2,1-2H3;1H/b17-16+;.
What are the key properties of 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide?
2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide has a molecular weight of 349.23 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxyphenyl)-3H-isoindol-1-imine;hydrobromide is sourced from PubChem (CID 2981480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).