C16H21N3OS2 — CID 2981778
3-[2-[(4-methoxy-3-methylphenyl)methylsulfanyl]ethyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione (PubChem CID 2981778) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 3-[2-[(4-methoxy-3-methylphenyl)methylsulfanyl]ethyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-[(4-methoxy-3-methylphenyl)methylsulfanyl]ethyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2981778 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-[2-[(4-methoxy-3-methylphenyl)methylsulfanyl]ethyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
| SMILES | C=CCn1c(CCSCc2ccc(OC)c(C)c2)n[nH]c1=S |
| InChI | InChI=1S/C16H21N3OS2/c1-4-8-19-15(17-18-16(19)21)7-9-22-11-13-5-6-14(20-3)12(2)10-13/h4-6,10H,1,7-9,11H2,2-3H3,(H,18,21) |
| InChIKey | PLDNIEYPOQEYHH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|