About 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid
3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid (PubChem CID 2982124) has the molecular formula C15H14N4O5S
and a molecular weight of 362.37 g/mol. Its IUPAC name is 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid.
Molecular Properties
| Compound Name | 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid |
| PubChem CID | 2982124 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid |
| SMILES | Cc1cc(C)nc(SCC(=O)Nc2cc(C(=O)O)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H14N4O5S/c1-8-3-9(2)17-15(16-8)25-7-13(20)18-11-4-10(14(21)22)5-12(6-11)19(23)24/h3-6H,7H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | GBVVVYZGZSVACV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid?
The IUPAC name of 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid (CID 2982124) is 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid.
What is the SMILES notation for 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid?
The canonical SMILES for 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid is Cc1cc(C)nc(SCC(=O)Nc2cc(C(=O)O)cc([N+](=O)[O-])c2)n1.
What is the InChIKey of 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid?
The InChIKey is GBVVVYZGZSVACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O5S/c1-8-3-9(2)17-15(16-8)25-7-13(20)18-11-4-10(14(21)22)5-12(6-11)19(23)24/h3-6H,7H2,1-2H3,(H,18,20)(H,21,22).
What are the key properties of 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid?
3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid has a molecular weight of 362.37 g/mol, XLogP of 2.43, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-5-nitrobenzoic acid is sourced from PubChem (CID 2982124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).