About N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine
N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine (PubChem CID 2982204) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine |
| PubChem CID | 2982204 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine |
| SMILES | CC1CCC(N(CCCN)Cc2ccco2)CC1C |
| InChI | InChI=1S/C16H28N2O/c1-13-6-7-15(11-14(13)2)18(9-4-8-17)12-16-5-3-10-19-16/h3,5,10,13-15H,4,6-9,11-12,17H2,1-2H3 |
| InChIKey | UDTRLIVLFCHUOX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine (CID 2982204) is N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine is CC1CCC(N(CCCN)Cc2ccco2)CC1C.
What is the InChIKey of N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine?
The InChIKey is UDTRLIVLFCHUOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O/c1-13-6-7-15(11-14(13)2)18(9-4-8-17)12-16-5-3-10-19-16/h3,5,10,13-15H,4,6-9,11-12,17H2,1-2H3.
What are the key properties of N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine?
N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine has a molecular weight of 264.41 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,4-dimethylcyclohexyl)-N'-(furan-2-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 2982204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).