C19H20F3N3O2 — CID 2982408
N-(3-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 2982408) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2982408 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(3-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-27-17-7-3-5-15(13-17)23-18(26)25-10-8-24(9-11-25)16-6-2-4-14(12-16)19(20,21)22/h2-7,12-13H,8-11H2,1H3,(H,23,26) |
| InChIKey | LZIMYPKYKOVBFF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |