C21H20ClN3O4 — CID 2982554
ethyl 4-[4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]benzoate (PubChem CID 2982554) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is ethyl 4-[4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]benzoate.
| Compound Name | ethyl 4-[4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]benzoate |
|---|---|
| PubChem CID | 2982554 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | ethyl 4-[4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCc2nc(-c3ccccc3Cl)no2)cc1 |
| InChI | InChI=1S/C21H20ClN3O4/c1-2-28-21(27)14-10-12-15(13-11-14)23-18(26)8-5-9-19-24-20(25-29-19)16-6-3-4-7-17(16)22/h3-4,6-7,10-13H,2,5,8-9H2,1H3,(H,23,26) |
| InChIKey | XKDSSIJRPPPTPE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |