C21H21N7O4S — CID 2982947
2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 2982947) has the molecular formula C21H21N7O4S and a molecular weight of 467.51 g/mol. Its IUPAC name is 2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2982947 |
| Molecular Formula | C21H21N7O4S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc(Nc2ccccc2)nc(N2CCOCC2)n1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N7O4S/c29-18(22-16-7-4-8-17(13-16)28(30)31)14-33-21-25-19(23-15-5-2-1-3-6-15)24-20(26-21)27-9-11-32-12-10-27/h1-8,13H,9-12,14H2,(H,22,29)(H,23,24,25,26) |
| InChIKey | ZEGPSZVPPTXHND-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|