C22H24N4O8 — CID 2983324
acetic acid;4-(4-hydroxy-3-methoxy-2-nitrophenyl)-6-methyl-N-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 2983324) has the molecular formula C22H24N4O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is acetic acid;4-(4-hydroxy-3-methoxy-2-nitrophenyl)-6-methyl-N-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | acetic acid;4-(4-hydroxy-3-methoxy-2-nitrophenyl)-6-methyl-N-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 2983324 |
| Molecular Formula | C22H24N4O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | acetic acid;4-(4-hydroxy-3-methoxy-2-nitrophenyl)-6-methyl-N-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC(=O)O.COc1c(O)ccc(C2NC(=O)NC(C)=C2C(=O)Nc2ccccc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O6.C2H4O2/c1-10-6-4-5-7-13(10)22-19(26)15-11(2)21-20(27)23-16(15)12-8-9-14(25)18(30-3)17(12)24(28)29;1-2(3)4/h4-9,16,25H,1-3H3,(H,22,26)(H2,21,23,27);1H3,(H,3,4) |
| InChIKey | LGVFSBZMTLEUEE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|