About 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride
5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride (PubChem CID 2983395) has the molecular formula C11H16ClN3O
and a molecular weight of 241.72 g/mol. Its IUPAC name is 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride |
| PubChem CID | 2983395 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride |
| SMILES | CCn1c(=O)n(CC)c2cc(N)ccc21.Cl |
| InChI | InChI=1S/C11H15N3O.ClH/c1-3-13-9-6-5-8(12)7-10(9)14(4-2)11(13)15;/h5-7H,3-4,12H2,1-2H3;1H |
| InChIKey | YLXUIVOFLBGAEX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride?
The IUPAC name of 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride (CID 2983395) is 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride.
What is the SMILES notation for 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride?
The canonical SMILES for 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride is CCn1c(=O)n(CC)c2cc(N)ccc21.Cl.
What is the InChIKey of 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride?
The InChIKey is YLXUIVOFLBGAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O.ClH/c1-3-13-9-6-5-8(12)7-10(9)14(4-2)11(13)15;/h5-7H,3-4,12H2,1-2H3;1H.
What are the key properties of 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride?
5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride has a molecular weight of 241.72 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-diethylbenzimidazol-2-one;hydrochloride is sourced from PubChem (CID 2983395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).