About 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole
1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole (PubChem CID 2983776) has the molecular formula C19H20N2O3S
and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole.
Molecular Properties
| Compound Name | 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole |
| PubChem CID | 2983776 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole |
| SMILES | COc1cc(C)c(S(=O)(=O)n2cc(C)nc2-c2ccccc2)cc1C |
| InChI | InChI=1S/C19H20N2O3S/c1-13-11-18(14(2)10-17(13)24-4)25(22,23)21-12-15(3)20-19(21)16-8-6-5-7-9-16/h5-12H,1-4H3 |
| InChIKey | IOSRESPDILIUNP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole?
The IUPAC name of 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole (CID 2983776) is 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole.
What is the SMILES notation for 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole?
The canonical SMILES for 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole is COc1cc(C)c(S(=O)(=O)n2cc(C)nc2-c2ccccc2)cc1C.
What is the InChIKey of 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole?
The InChIKey is IOSRESPDILIUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3S/c1-13-11-18(14(2)10-17(13)24-4)25(22,23)21-12-15(3)20-19(21)16-8-6-5-7-9-16/h5-12H,1-4H3.
What are the key properties of 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole?
1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole has a molecular weight of 356.45 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-2,5-dimethylphenyl)sulfonyl-4-methyl-2-phenylimidazole is sourced from PubChem (CID 2983776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).