C18H19N5O — CID 2984389
1-[5-(benzylamino)-3-pyridin-3-yl-1,2,4-triazol-1-yl]butan-1-one (PubChem CID 2984389) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[5-(benzylamino)-3-pyridin-3-yl-1,2,4-triazol-1-yl]butan-1-one.
| Compound Name | 1-[5-(benzylamino)-3-pyridin-3-yl-1,2,4-triazol-1-yl]butan-1-one |
|---|---|
| PubChem CID | 2984389 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[5-(benzylamino)-3-pyridin-3-yl-1,2,4-triazol-1-yl]butan-1-one |
| SMILES | CCCC(=O)n1nc(-c2cccnc2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C18H19N5O/c1-2-7-16(24)23-18(20-12-14-8-4-3-5-9-14)21-17(22-23)15-10-6-11-19-13-15/h3-6,8-11,13H,2,7,12H2,1H3,(H,20,21,22) |
| InChIKey | WBIKFLYXZQQTKG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |