C20H25ClN4O3S2 — CID 2984398
5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpyrimidine-4-carboxamide (PubChem CID 2984398) has the molecular formula C20H25ClN4O3S2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 2984398 |
| Molecular Formula | C20H25ClN4O3S2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpyrimidine-4-carboxamide |
| SMILES | CCSc1ncc(Cl)c(C(=O)N(Cc2ccc(N(C)C)cc2)C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C20H25ClN4O3S2/c1-4-29-20-22-11-17(21)18(23-20)19(26)25(16-9-10-30(27,28)13-16)12-14-5-7-15(8-6-14)24(2)3/h5-8,11,16H,4,9-10,12-13H2,1-3H3 |
| InChIKey | UBQBAURJAMTQHI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|