C16H17N3O2 — CID 2984464
1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-amine (PubChem CID 2984464) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-amine.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 2984464 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-amine |
| SMILES | COc1ccccc1OCCn1c(N)nc2ccccc21 |
| InChI | InChI=1S/C16H17N3O2/c1-20-14-8-4-5-9-15(14)21-11-10-19-13-7-3-2-6-12(13)18-16(19)17/h2-9H,10-11H2,1H3,(H2,17,18) |
| InChIKey | FGFCLYKICHXLMH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |