C16H17N3O5 — CID 2984647
N-(furan-2-ylmethyl)-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 2984647) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 2984647 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | O=C(NCc1ccco1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H17N3O5/c20-16(17-11-13-2-1-7-24-13)14-10-12(19(21)22)3-4-15(14)18-5-8-23-9-6-18/h1-4,7,10H,5-6,8-9,11H2,(H,17,20) |
| InChIKey | OOQJJDYDPICUOX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|