C20H30N2O2 — CID 2984762
1-N,1-N,4-N,4-N-tetrakis(prop-2-enyl)cyclohexane-1,4-dicarboxamide (PubChem CID 2984762) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetrakis(prop-2-enyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,1-N,4-N,4-N-tetrakis(prop-2-enyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 2984762 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetrakis(prop-2-enyl)cyclohexane-1,4-dicarboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CCC(C(=O)N(CC=C)CC=C)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-5-13-21(14-6-2)19(23)17-9-11-18(12-10-17)20(24)22(15-7-3)16-8-4/h5-8,17-18H,1-4,9-16H2 |
| InChIKey | LUANGBZEIUHEOZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|