C14H19NO2 — CID 2985161
N-butyl-3,4-dihydro-1H-isochromene-1-carboxamide (PubChem CID 2985161) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-butyl-3,4-dihydro-1H-isochromene-1-carboxamide.
| Compound Name | N-butyl-3,4-dihydro-1H-isochromene-1-carboxamide |
|---|---|
| PubChem CID | 2985161 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-butyl-3,4-dihydro-1H-isochromene-1-carboxamide |
| SMILES | CCCCNC(=O)C1OCCc2ccccc21 |
| InChI | InChI=1S/C14H19NO2/c1-2-3-9-15-14(16)13-12-7-5-4-6-11(12)8-10-17-13/h4-7,13H,2-3,8-10H2,1H3,(H,15,16) |
| InChIKey | RFWRLJQUDNYJPO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|