About 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone
1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 2985256) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| PubChem CID | 2985256 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | COc1ccc(C2=NN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C12H14N2O2/c1-9(15)14-8-7-12(13-14)10-3-5-11(16-2)6-4-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | ICBSJEHUKQDJSE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone?
The IUPAC name of 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone (CID 2985256) is 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone.
What is the SMILES notation for 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone?
The canonical SMILES for 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone is COc1ccc(C2=NN(C(C)=O)CC2)cc1.
What is the InChIKey of 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone?
The InChIKey is ICBSJEHUKQDJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-9(15)14-8-7-12(13-14)10-3-5-11(16-2)6-4-10/h3-6H,7-8H2,1-2H3.
What are the key properties of 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone?
1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone has a molecular weight of 218.26 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone is sourced from PubChem (CID 2985256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).