About N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide
N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide (PubChem CID 2985471) has the molecular formula C17H17ClN2O4
and a molecular weight of 348.79 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide.
Molecular Properties
| Compound Name | N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide |
| PubChem CID | 2985471 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C17H17ClN2O4/c1-23-14-8-7-13(9-15(14)24-2)20-17(22)16(21)19-10-11-3-5-12(18)6-4-11/h3-9H,10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ONERQUCIWKNSIE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide?
The IUPAC name of N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide (CID 2985471) is N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide.
What is the SMILES notation for N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide?
The canonical SMILES for N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide is COc1ccc(NC(=O)C(=O)NCc2ccc(Cl)cc2)cc1OC.
What is the InChIKey of N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide?
The InChIKey is ONERQUCIWKNSIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O4/c1-23-14-8-7-13(9-15(14)24-2)20-17(22)16(21)19-10-11-3-5-12(18)6-4-11/h3-9H,10H2,1-2H3,(H,19,21)(H,20,22).
What are the key properties of N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide?
N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide has a molecular weight of 348.79 g/mol, XLogP of 2.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorophenyl)methyl]-N'-(3,4-dimethoxyphenyl)oxamide is sourced from PubChem (CID 2985471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).