C20H22N2O4S — CID 2985803
N-(2-methoxyethyl)-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide (PubChem CID 2985803) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2985803 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(2-methoxyethyl)-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
| SMILES | COCCN(Cc1cc2ccc(C)cc2[nH]c1=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-15-8-9-16-13-17(20(23)21-19(16)12-15)14-22(10-11-26-2)27(24,25)18-6-4-3-5-7-18/h3-9,12-13H,10-11,14H2,1-2H3,(H,21,23) |
| InChIKey | CCGLLKFSOINILC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |