C21H16FNO3S — CID 2986361
1-[(3-fluorophenyl)methyl]-3-hydroxy-3-(2-oxo-2-thiophen-2-ylethyl)indol-2-one (PubChem CID 2986361) has the molecular formula C21H16FNO3S and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-hydroxy-3-(2-oxo-2-thiophen-2-ylethyl)indol-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-hydroxy-3-(2-oxo-2-thiophen-2-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 2986361 |
| Molecular Formula | C21H16FNO3S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-hydroxy-3-(2-oxo-2-thiophen-2-ylethyl)indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2cccc(F)c2)c2ccccc21)c1cccs1 |
| InChI | InChI=1S/C21H16FNO3S/c22-15-6-3-5-14(11-15)13-23-17-8-2-1-7-16(17)21(26,20(23)25)12-18(24)19-9-4-10-27-19/h1-11,26H,12-13H2 |
| InChIKey | NVNLCBUHGUOUOC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |