C21H20N4O2S — CID 2986371
N-(4-acetylphenyl)-7-amino-5-thia-1,3-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,6,8-tetraene-6-carboxamide (PubChem CID 2986371) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-(4-acetylphenyl)-7-amino-5-thia-1,3-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,6,8-tetraene-6-carboxamide.
| Compound Name | N-(4-acetylphenyl)-7-amino-5-thia-1,3-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 2986371 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(4-acetylphenyl)-7-amino-5-thia-1,3-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,6,8-tetraene-6-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2sc3nc4c(cc3c2N)C2CCN4CC2)cc1 |
| InChI | InChI=1S/C21H20N4O2S/c1-11(26)12-2-4-14(5-3-12)23-20(27)18-17(22)16-10-15-13-6-8-25(9-7-13)19(15)24-21(16)28-18/h2-5,10,13H,6-9,22H2,1H3,(H,23,27) |
| InChIKey | MXXRIHFXGWHZAP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |