About N'-(2-bromo-4,6-difluorophenyl)oxamide
N'-(2-bromo-4,6-difluorophenyl)oxamide (PubChem CID 2986891) has the molecular formula C8H5BrF2N2O2
and a molecular weight of 279.04 g/mol. Its IUPAC name is N'-(2-bromo-4,6-difluorophenyl)oxamide.
Molecular Properties
| Compound Name | N'-(2-bromo-4,6-difluorophenyl)oxamide |
| PubChem CID | 2986891 |
| Molecular Formula | C8H5BrF2N2O2 |
| Molecular Weight | 279.04 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | N'-(2-bromo-4,6-difluorophenyl)oxamide |
| SMILES | NC(=O)C(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H5BrF2N2O2/c9-4-1-3(10)2-5(11)6(4)13-8(15)7(12)14/h1-2H,(H2,12,14)(H,13,15) |
| InChIKey | LVVQOOWBARKXJP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.04 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-bromo-4,6-difluorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-bromo-4,6-difluorophenyl)oxamide?
The IUPAC name of N'-(2-bromo-4,6-difluorophenyl)oxamide (CID 2986891) is N'-(2-bromo-4,6-difluorophenyl)oxamide.
What is the SMILES notation for N'-(2-bromo-4,6-difluorophenyl)oxamide?
The canonical SMILES for N'-(2-bromo-4,6-difluorophenyl)oxamide is NC(=O)C(=O)Nc1c(F)cc(F)cc1Br.
What is the InChIKey of N'-(2-bromo-4,6-difluorophenyl)oxamide?
The InChIKey is LVVQOOWBARKXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF2N2O2/c9-4-1-3(10)2-5(11)6(4)13-8(15)7(12)14/h1-2H,(H2,12,14)(H,13,15).
What are the key properties of N'-(2-bromo-4,6-difluorophenyl)oxamide?
N'-(2-bromo-4,6-difluorophenyl)oxamide has a molecular weight of 279.04 g/mol, XLogP of 1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-bromo-4,6-difluorophenyl)oxamide is sourced from PubChem (CID 2986891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).