C16H24N2O4S — CID 2987015
3-(hydroxymethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carbothioamide (PubChem CID 2987015) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carbothioamide.
| Compound Name | 3-(hydroxymethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2987015 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-(hydroxymethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCCC(CO)C2)cc(OC)c1OC |
| InChI | InChI=1S/C16H24N2O4S/c1-20-13-7-12(8-14(21-2)15(13)22-3)17-16(23)18-6-4-5-11(9-18)10-19/h7-8,11,19H,4-6,9-10H2,1-3H3,(H,17,23) |
| InChIKey | HEJDWENGCSCVJQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|