C17H16N4O2S — CID 2987434
N'-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 2987434) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N'-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 2987434 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N'-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | N#Cc1c(NC(=O)C(=O)NCc2ccncc2)sc2c1CCCC2 |
| InChI | InChI=1S/C17H16N4O2S/c18-9-13-12-3-1-2-4-14(12)24-17(13)21-16(23)15(22)20-10-11-5-7-19-8-6-11/h5-8H,1-4,10H2,(H,20,22)(H,21,23) |
| InChIKey | KNCVKQNNICSBAY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|