C18H21N3O3 — CID 2988570
N-[3-[[2-(4-methylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide (PubChem CID 2988570) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[3-[[2-(4-methylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[2-(4-methylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2988570 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[3-[[2-(4-methylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCC(=O)NCCCNC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-14-5-7-16(8-6-14)24-13-17(22)20-10-3-11-21-18(23)15-4-2-9-19-12-15/h2,4-9,12H,3,10-11,13H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ORIVODMXKLPPIV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|