C14H21N7O2 — CID 2989074
6-[[4-(butylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]-2-methylpyridazin-3-one (PubChem CID 2989074) has the molecular formula C14H21N7O2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 6-[[4-(butylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]-2-methylpyridazin-3-one.
| Compound Name | 6-[[4-(butylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 2989074 |
| Molecular Formula | C14H21N7O2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 6-[[4-(butylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]oxy]-2-methylpyridazin-3-one |
| SMILES | CCCCNc1nc(Oc2ccc(=O)n(C)n2)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H21N7O2/c1-5-6-9-15-12-16-13(20(2)3)18-14(17-12)23-10-7-8-11(22)21(4)19-10/h7-8H,5-6,9H2,1-4H3,(H,15,16,17,18) |
| InChIKey | GUXJLLXOUFKPIB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|