C21H21F4NO3 — CID 2989740
4-[3-[4-(4-ethoxyphenoxy)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine (PubChem CID 2989740) has the molecular formula C21H21F4NO3 and a molecular weight of 411.40 g/mol. Its IUPAC name is 4-[3-[4-(4-ethoxyphenoxy)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine.
| Compound Name | 4-[3-[4-(4-ethoxyphenoxy)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine |
|---|---|
| PubChem CID | 2989740 |
| Molecular Formula | C21H21F4NO3 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[3-[4-(4-ethoxyphenoxy)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine |
| SMILES | CCOc1ccc(Oc2c(F)c(F)c(C=CCN3CCOCC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H21F4NO3/c1-2-28-14-5-7-15(8-6-14)29-21-19(24)17(22)16(18(23)20(21)25)4-3-9-26-10-12-27-13-11-26/h3-8H,2,9-13H2,1H3 |
| InChIKey | YKEINGGVJNBZLX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|