C13H16FN3O3S — CID 2989910
5-fluoro-N-(3-imidazol-1-ylpropyl)-2-methoxybenzenesulfonamide (PubChem CID 2989910) has the molecular formula C13H16FN3O3S and a molecular weight of 313.35 g/mol. Its IUPAC name is 5-fluoro-N-(3-imidazol-1-ylpropyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-fluoro-N-(3-imidazol-1-ylpropyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2989910 |
| Molecular Formula | C13H16FN3O3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-fluoro-N-(3-imidazol-1-ylpropyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C13H16FN3O3S/c1-20-12-4-3-11(14)9-13(12)21(18,19)16-5-2-7-17-8-6-15-10-17/h3-4,6,8-10,16H,2,5,7H2,1H3 |
| InChIKey | HJUVGABASQWXDJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|