About N-(2,5-dihydroxyphenyl)-N-methylnitrous amide
N-(2,5-dihydroxyphenyl)-N-methylnitrous amide (PubChem CID 2990) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is N-(2,5-dihydroxyphenyl)-N-methylnitrous amide.
Molecular Properties
| Compound Name | N-(2,5-dihydroxyphenyl)-N-methylnitrous amide |
| PubChem CID | 2990 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | N-(2,5-dihydroxyphenyl)-N-methylnitrous amide |
| SMILES | CN(N=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C7H8N2O3/c1-9(8-12)6-4-5(10)2-3-7(6)11/h2-4,10-11H,1H3 |
| InChIKey | HCJOLYFWJWJPTJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dihydroxyphenyl)-N-methylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dihydroxyphenyl)-N-methylnitrous amide?
The IUPAC name of N-(2,5-dihydroxyphenyl)-N-methylnitrous amide (CID 2990) is N-(2,5-dihydroxyphenyl)-N-methylnitrous amide.
What is the SMILES notation for N-(2,5-dihydroxyphenyl)-N-methylnitrous amide?
The canonical SMILES for N-(2,5-dihydroxyphenyl)-N-methylnitrous amide is CN(N=O)c1cc(O)ccc1O.
What is the InChIKey of N-(2,5-dihydroxyphenyl)-N-methylnitrous amide?
The InChIKey is HCJOLYFWJWJPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-9(8-12)6-4-5(10)2-3-7(6)11/h2-4,10-11H,1H3.
What are the key properties of N-(2,5-dihydroxyphenyl)-N-methylnitrous amide?
N-(2,5-dihydroxyphenyl)-N-methylnitrous amide has a molecular weight of 168.15 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dihydroxyphenyl)-N-methylnitrous amide is sourced from PubChem (CID 2990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).